Triolein | ||||
---|---|---|---|---|
Structuurformule en molecuulmodel | ||||
Structuurformule van glyceryltrioleaat
| ||||
Algemeen | ||||
Molecuulformule | C57H104O6 | |||
IUPAC-naam | 2,3-Bis[[(Z)-octadec-9-enoyl]oxy]propyl (Z)-octadec-9-enoaat | |||
Molmassa | 885,432 g/mol | |||
SMILES | O=C(OCC(OC(=O)CCCCCCC\C=C/CCCCCCCC)COC(=O)CCCCCCC\C=C/CCCCCCCC)CCCCCCC\C=C/CCCCCCCC
| |||
CAS-nummer | 122-32-7 | |||
PubChem | 5497163 | |||
Wikidata | Q413929 | |||
Beschrijving | Kleurloze, stroperige vloeistof | |||
Fysische eigenschappen | ||||
Smeltpunt | 4,85 °C | |||
Kookpunt | 554,25 °C | |||
Tenzij anders vermeld zijn standaardomstandigheden gebruikt (298,15 K of 25 °C, 1 bar). | ||||
|
Glyceryltrioleaat of trioleine is een gecondenseerde binding tussen glycerol (propaan-1,2,3-triol) en oliezuur. De moleculen bevatten drie estergroepen.